C31H30IrNO2- — CID 167354105
(Z)-4-hydroxypent-3-en-2-one;iridium;1-methanidyl-2-(3-methanidyl-9,9-dimethylfluoren-2-yl)quinolin-1-ium (PubChem CID 167354105) has the molecular formula C31H30IrNO2- and a molecular weight of 640.80 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;1-methanidyl-2-(3-methanidyl-9,9-dimethylfluoren-2-yl)quinolin-1-ium.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;1-methanidyl-2-(3-methanidyl-9,9-dimethylfluoren-2-yl)quinolin-1-ium |
|---|---|
| PubChem CID | 167354105 |
| Molecular Formula | C31H30IrNO2- |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 641.19 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;1-methanidyl-2-(3-methanidyl-9,9-dimethylfluoren-2-yl)quinolin-1-ium |
| SMILES | CC(=O)/C=C(/C)O.[CH2-]c1cc2c(cc1-c1ccc3ccccc3[n+]1[CH2-])C(C)(C)c1ccccc1-2.[Ir] |
| InChI | InChI=1S/C26H22N.C5H8O2.Ir/c1-17-15-21-19-10-6-7-11-22(19)26(2,3)23(21)16-20(17)25-14-13-18-9-5-8-12-24(18)27(25)4;1-4(6)3-5(2)7;/h5-16H,1,4H2,2-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | KLBVCMZWOKGQCE-LWFKIUJUSA-N |
| XLogP | 6.96 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|