C43H46BCuN2+ — CID 167354112
copper;1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-1,3-benzazaborol-1-ium-2-ide;carbazol-9-ide (PubChem CID 167354112) has the molecular formula C43H46BCuN2+ and a molecular weight of 665.21 g/mol. Its IUPAC name is copper;1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-1,3-benzazaborol-1-ium-2-ide;carbazol-9-ide.
| Compound Name | copper;1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-1,3-benzazaborol-1-ium-2-ide;carbazol-9-ide |
|---|---|
| PubChem CID | 167354112 |
| Molecular Formula | C43H46BCuN2+ |
| Molecular Weight | 665.21 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | copper;1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-1,3-benzazaborol-1-ium-2-ide;carbazol-9-ide |
| SMILES | CC(C)c1cccc(C(C)C)c1B1[C-]=[N+](c2c(C(C)C)cccc2C(C)C)c2ccccc21.[Cu+2].c1ccc2c(c1)[n-]c1ccccc12 |
| InChI | InChI=1S/C31H38BN.C12H8N.Cu/c1-20(2)24-13-11-14-25(21(3)4)30(24)32-19-33(29-18-10-9-17-28(29)32)31-26(22(5)6)15-12-16-27(31)23(7)8;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h9-18,20-23H,1-8H3;1-8H;/q;-1;+2 |
| InChIKey | KQGJVQNZHRYNPI-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 17.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.21 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|