C31H51N3O6 — CID 167356611
tert-butyl 4-[[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropoxy]carbonylamino]benzoate (PubChem CID 167356611) has the molecular formula C31H51N3O6 and a molecular weight of 561.76 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropoxy]carbonylamino]benzoate.
| Compound Name | tert-butyl 4-[[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropoxy]carbonylamino]benzoate |
|---|---|
| PubChem CID | 167356611 |
| Molecular Formula | C31H51N3O6 |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.38 |
| IUPAC Name | tert-butyl 4-[[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropoxy]carbonylamino]benzoate |
| SMILES | CCCCCCCCCC(=O)N[C@@H](COC(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1)C(=O)NCCCCCC |
| InChI | InChI=1S/C31H51N3O6/c1-6-8-10-12-13-14-15-17-27(35)34-26(28(36)32-22-16-11-9-7-2)23-39-30(38)33-25-20-18-24(19-21-25)29(37)40-31(3,4)5/h18-21,26H,6-17,22-23H2,1-5H3,(H,32,36)(H,33,38)(H,34,35)/t26-/m0/s1 |
| InChIKey | IETWCISXTGSZFF-SANMLTNESA-N |
| XLogP | 6.51 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|