C27H43N3O6S — CID 167357076
methyl 3-[(3S)-3-(hexylcarbamoyl)-4-octanoylpiperazin-1-yl]sulfonylbenzoate (PubChem CID 167357076) has the molecular formula C27H43N3O6S and a molecular weight of 537.72 g/mol. Its IUPAC name is methyl 3-[(3S)-3-(hexylcarbamoyl)-4-octanoylpiperazin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 3-[(3S)-3-(hexylcarbamoyl)-4-octanoylpiperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 167357076 |
| Molecular Formula | C27H43N3O6S |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | methyl 3-[(3S)-3-(hexylcarbamoyl)-4-octanoylpiperazin-1-yl]sulfonylbenzoate |
| SMILES | CCCCCCCC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)OC)c2)C[C@H]1C(=O)NCCCCCC |
| InChI | InChI=1S/C27H43N3O6S/c1-4-6-8-10-11-16-25(31)30-19-18-29(21-24(30)26(32)28-17-12-9-7-5-2)37(34,35)23-15-13-14-22(20-23)27(33)36-3/h13-15,20,24H,4-12,16-19,21H2,1-3H3,(H,28,32)/t24-/m0/s1 |
| InChIKey | INSMOZIZZJCQEF-DEOSSOPVSA-N |
| XLogP | 3.73 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|