C27H29N2S+ — CID 167365016
1-methyl-2-(2-methyl-7-propan-2-yldibenzothiophen-1-yl)-3-propan-2-ylbenzimidazol-1-ium (PubChem CID 167365016) has the molecular formula C27H29N2S+ and a molecular weight of 413.61 g/mol. Its IUPAC name is 1-methyl-2-(2-methyl-7-propan-2-yldibenzothiophen-1-yl)-3-propan-2-ylbenzimidazol-1-ium.
| Compound Name | 1-methyl-2-(2-methyl-7-propan-2-yldibenzothiophen-1-yl)-3-propan-2-ylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 167365016 |
| Molecular Formula | C27H29N2S+ |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-methyl-2-(2-methyl-7-propan-2-yldibenzothiophen-1-yl)-3-propan-2-ylbenzimidazol-1-ium |
| SMILES | Cc1ccc2sc3cc(C(C)C)ccc3c2c1-c1n(C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C27H29N2S/c1-16(2)19-12-13-20-24(15-19)30-23-14-11-18(5)25(26(20)23)27-28(6)21-9-7-8-10-22(21)29(27)17(3)4/h7-17H,1-6H3/q+1 |
| InChIKey | HCEWEKYPBQIKFD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|