C16H19NO — CID 16736681
[4-[(1S,2R,6S,7R)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]methanol (PubChem CID 16736681) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is [4-[(1S,2R,6S,7R)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]methanol.
| Compound Name | [4-[(1S,2R,6S,7R)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 16736681 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | [4-[(1S,2R,6S,7R)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]methanol |
| SMILES | OCc1ccc(N2C[C@@H]3[C@H](C2)[C@@H]2C=C[C@H]3C2)cc1 |
| InChI | InChI=1S/C16H19NO/c18-10-11-1-5-14(6-2-11)17-8-15-12-3-4-13(7-12)16(15)9-17/h1-6,12-13,15-16,18H,7-10H2/t12-,13+,15-,16+ |
| InChIKey | VVVIJNBBLQDQAF-SDSIWUNFSA-N |
| XLogP | 2.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|