C19H27FN2O — CID 167369064
(1S,2S,5R)-2-fluoro-9-[(4-methoxyphenyl)methyl]-N,1,5-trimethyl-9-azabicyclo[3.3.1]nonan-3-imine (PubChem CID 167369064) has the molecular formula C19H27FN2O and a molecular weight of 318.44 g/mol. Its IUPAC name is (1S,2S,5R)-2-fluoro-9-[(4-methoxyphenyl)methyl]-N,1,5-trimethyl-9-azabicyclo[3.3.1]nonan-3-imine.
| Compound Name | (1S,2S,5R)-2-fluoro-9-[(4-methoxyphenyl)methyl]-N,1,5-trimethyl-9-azabicyclo[3.3.1]nonan-3-imine |
|---|---|
| PubChem CID | 167369064 |
| Molecular Formula | C19H27FN2O |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (1S,2S,5R)-2-fluoro-9-[(4-methoxyphenyl)methyl]-N,1,5-trimethyl-9-azabicyclo[3.3.1]nonan-3-imine |
| SMILES | C/N=C1\C[C@@]2(C)CCC[C@@](C)([C@@H]1F)N2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H27FN2O/c1-18-10-5-11-19(2,17(20)16(12-18)21-3)22(18)13-14-6-8-15(23-4)9-7-14/h6-9,17H,5,10-13H2,1-4H3/b21-16+/t17-,18-,19+/m1/s1 |
| InChIKey | PYQNLWMDOCDFTJ-DIHIYWFUSA-N |
| XLogP | 4.01 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|