C14H10F2W — CID 167370501
1,3-difluoro-2-methyl-5-(4-methylbenzene-6-id-1-yl)benzene-6-ide;tungsten(2+) (PubChem CID 167370501) has the molecular formula C14H10F2W and a molecular weight of 400.07 g/mol. Its IUPAC name is 1,3-difluoro-2-methyl-5-(4-methylbenzene-6-id-1-yl)benzene-6-ide;tungsten(2+).
| Compound Name | 1,3-difluoro-2-methyl-5-(4-methylbenzene-6-id-1-yl)benzene-6-ide;tungsten(2+) |
|---|---|
| PubChem CID | 167370501 |
| Molecular Formula | C14H10F2W |
| Molecular Weight | 400.07 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 1,3-difluoro-2-methyl-5-(4-methylbenzene-6-id-1-yl)benzene-6-ide;tungsten(2+) |
| SMILES | Cc1c[c-]c(-c2[c-]c(F)c(C)c(F)c2)cc1.[W+2] |
| InChI | InChI=1S/C14H10F2.W/c1-9-3-5-11(6-4-9)12-7-13(15)10(2)14(16)8-12;/h3-5,7H,1-2H3;/q-2;+2 |
| InChIKey | HZUDNFRAVZARDU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.07 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|