C18H21N3O4S — CID 167378570
[methanesulfonamido-(6-phenyl-2-pyridinyl)methyl] pyrrolidine-1-carboxylate (PubChem CID 167378570) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is [methanesulfonamido-(6-phenyl-2-pyridinyl)methyl] pyrrolidine-1-carboxylate.
| Compound Name | [methanesulfonamido-(6-phenyl-2-pyridinyl)methyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167378570 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [methanesulfonamido-(6-phenyl-2-pyridinyl)methyl] pyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)NC(OC(=O)N1CCCC1)c1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H21N3O4S/c1-26(23,24)20-17(25-18(22)21-12-5-6-13-21)16-11-7-10-15(19-16)14-8-3-2-4-9-14/h2-4,7-11,17,20H,5-6,12-13H2,1H3 |
| InChIKey | RBDYKOBXCWVMLH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|