C16H31NO8 — CID 167388218
2-[3-[[4-hydroxy-2-(3-hydroxypropoxymethyl)butoxy]carbonylamino]propoxy]ethyl acetate (PubChem CID 167388218) has the molecular formula C16H31NO8 and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-[3-[[4-hydroxy-2-(3-hydroxypropoxymethyl)butoxy]carbonylamino]propoxy]ethyl acetate.
| Compound Name | 2-[3-[[4-hydroxy-2-(3-hydroxypropoxymethyl)butoxy]carbonylamino]propoxy]ethyl acetate |
|---|---|
| PubChem CID | 167388218 |
| Molecular Formula | C16H31NO8 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-[3-[[4-hydroxy-2-(3-hydroxypropoxymethyl)butoxy]carbonylamino]propoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCCCNC(=O)OCC(CCO)COCCCO |
| InChI | InChI=1S/C16H31NO8/c1-14(20)24-11-10-22-8-2-5-17-16(21)25-13-15(4-7-19)12-23-9-3-6-18/h15,18-19H,2-13H2,1H3,(H,17,21) |
| InChIKey | GNKDNMRZACDHRN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|