C13H14F2INO6S — CID 167388489
1,1-difluoro-2-[4-[(4-iodobenzoyl)amino]butanoyloxy]ethanesulfonic acid (PubChem CID 167388489) has the molecular formula C13H14F2INO6S and a molecular weight of 477.22 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[(4-iodobenzoyl)amino]butanoyloxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[4-[(4-iodobenzoyl)amino]butanoyloxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 167388489 |
| Molecular Formula | C13H14F2INO6S |
| Molecular Weight | 477.22 g/mol |
| Exact Mass | 476.96 |
| IUPAC Name | 1,1-difluoro-2-[4-[(4-iodobenzoyl)amino]butanoyloxy]ethanesulfonic acid |
| SMILES | O=C(CCCNC(=O)c1ccc(I)cc1)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C13H14F2INO6S/c14-13(15,24(20,21)22)8-23-11(18)2-1-7-17-12(19)9-3-5-10(16)6-4-9/h3-6H,1-2,7-8H2,(H,17,19)(H,20,21,22) |
| InChIKey | YVGWMJLQWAWKMF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|