C35H39NO5 — CID 167395589
(E,2S,3S,4S,5S)-N-methoxy-2,3,4,5-tetrakis(phenylmethoxy)hexan-1-imine (PubChem CID 167395589) has the molecular formula C35H39NO5 and a molecular weight of 553.70 g/mol. Its IUPAC name is (E,2S,3S,4S,5S)-N-methoxy-2,3,4,5-tetrakis(phenylmethoxy)hexan-1-imine.
| Compound Name | (E,2S,3S,4S,5S)-N-methoxy-2,3,4,5-tetrakis(phenylmethoxy)hexan-1-imine |
|---|---|
| PubChem CID | 167395589 |
| Molecular Formula | C35H39NO5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | (E,2S,3S,4S,5S)-N-methoxy-2,3,4,5-tetrakis(phenylmethoxy)hexan-1-imine |
| SMILES | CO/N=C/[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C35H39NO5/c1-28(38-24-29-15-7-3-8-16-29)34(40-26-31-19-11-5-12-20-31)35(41-27-32-21-13-6-14-22-32)33(23-36-37-2)39-25-30-17-9-4-10-18-30/h3-23,28,33-35H,24-27H2,1-2H3/b36-23+/t28-,33-,34-,35-/m0/s1 |
| InChIKey | WYWGPODHPYKNFR-VLJCSQBNSA-N |
| XLogP | 6.98 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|