C45H49NO8 — CID 167395669
methyl 2-[phenylmethoxycarbonyl-[(2S,3S,4S,5S)-2,3,4,5-tetrakis(phenylmethoxy)hexyl]amino]acetate (PubChem CID 167395669) has the molecular formula C45H49NO8 and a molecular weight of 731.89 g/mol. Its IUPAC name is methyl 2-[phenylmethoxycarbonyl-[(2S,3S,4S,5S)-2,3,4,5-tetrakis(phenylmethoxy)hexyl]amino]acetate.
| Compound Name | methyl 2-[phenylmethoxycarbonyl-[(2S,3S,4S,5S)-2,3,4,5-tetrakis(phenylmethoxy)hexyl]amino]acetate |
|---|---|
| PubChem CID | 167395669 |
| Molecular Formula | C45H49NO8 |
| Molecular Weight | 731.89 g/mol |
| Exact Mass | 731.35 |
| IUPAC Name | methyl 2-[phenylmethoxycarbonyl-[(2S,3S,4S,5S)-2,3,4,5-tetrakis(phenylmethoxy)hexyl]amino]acetate |
| SMILES | COC(=O)CN(C[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](C)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C45H49NO8/c1-35(50-30-36-18-8-3-9-19-36)43(52-32-38-22-12-5-13-23-38)44(53-33-39-24-14-6-15-25-39)41(51-31-37-20-10-4-11-21-37)28-46(29-42(47)49-2)45(48)54-34-40-26-16-7-17-27-40/h3-27,35,41,43-44H,28-34H2,1-2H3/t35-,41-,43-,44-/m0/s1 |
| InChIKey | UOZYQTGYDNGTRT-JIXAVYTESA-N |
| XLogP | 8.16 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.89 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |