C15H25N — CID 167425075
9-deuterio-3,4-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 167425075) has the molecular formula C15H25N and a molecular weight of 220.38 g/mol. Its IUPAC name is 9-deuterio-3,4-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | 9-deuterio-3,4-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 167425075 |
| Molecular Formula | C15H25N |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.20 |
| IUPAC Name | 9-deuterio-3,4-di(propan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | [2H]C1=CC2CC1C1C2CN(C(C)C)C1C(C)C |
| InChI | InChI=1S/C15H25N/c1-9(2)15-14-12-6-5-11(7-12)13(14)8-16(15)10(3)4/h5-6,9-15H,7-8H2,1-4H3/i6D |
| InChIKey | SXJPBUNUIUJBCN-RAMDWTOOSA-N |
| XLogP | 3.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|