C17H27F2NO4 — CID 167425149
2-O-tert-butyl 1-O-methyl (1S,3aR,4S,7S,7aR)-6,6-difluoro-4,7-dimethyl-3,3a,4,5,7,7a-hexahydro-1H-isoindole-1,2-dicarboxylate (PubChem CID 167425149) has the molecular formula C17H27F2NO4 and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-methyl (1S,3aR,4S,7S,7aR)-6,6-difluoro-4,7-dimethyl-3,3a,4,5,7,7a-hexahydro-1H-isoindole-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-methyl (1S,3aR,4S,7S,7aR)-6,6-difluoro-4,7-dimethyl-3,3a,4,5,7,7a-hexahydro-1H-isoindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 167425149 |
| Molecular Formula | C17H27F2NO4 |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-O-tert-butyl 1-O-methyl (1S,3aR,4S,7S,7aR)-6,6-difluoro-4,7-dimethyl-3,3a,4,5,7,7a-hexahydro-1H-isoindole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)OC(C)(C)C)[C@@H](C)CC(F)(F)[C@H]2C |
| InChI | InChI=1S/C17H27F2NO4/c1-9-7-17(18,19)10(2)12-11(9)8-20(13(12)14(21)23-6)15(22)24-16(3,4)5/h9-13H,7-8H2,1-6H3/t9-,10-,11+,12-,13-/m0/s1 |
| InChIKey | WJLTXQSUYPQGID-WJTVCTBASA-N |
| XLogP | 3.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |