C18H29NO4 — CID 167425019
2-O-tert-butyl 1-O-methyl (1S,3aR,4S,7S,7aS)-4,7-dimethyl-6-methylidene-3,3a,4,5,7,7a-hexahydro-1H-isoindole-1,2-dicarboxylate (PubChem CID 167425019) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-methyl (1S,3aR,4S,7S,7aS)-4,7-dimethyl-6-methylidene-3,3a,4,5,7,7a-hexahydro-1H-isoindole-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-methyl (1S,3aR,4S,7S,7aS)-4,7-dimethyl-6-methylidene-3,3a,4,5,7,7a-hexahydro-1H-isoindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 167425019 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-O-tert-butyl 1-O-methyl (1S,3aR,4S,7S,7aS)-4,7-dimethyl-6-methylidene-3,3a,4,5,7,7a-hexahydro-1H-isoindole-1,2-dicarboxylate |
| SMILES | C=C1C[C@H](C)[C@H]2CN(C(=O)OC(C)(C)C)[C@H](C(=O)OC)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C18H29NO4/c1-10-8-11(2)13-9-19(17(21)23-18(4,5)6)15(16(20)22-7)14(13)12(10)3/h11-15H,1,8-9H2,2-7H3/t11-,12+,13+,14-,15-/m0/s1 |
| InChIKey | KWMLHNNGLRVVJF-QRTUWBSPSA-N |
| XLogP | 3.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|