C16H21NO5 — CID 174169327
4-O-tert-butyl 3-O-methyl (2R,3S,6S)-10-oxo-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,4-dicarboxylate (PubChem CID 174169327) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-O-tert-butyl 3-O-methyl (2R,3S,6S)-10-oxo-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 3-O-methyl (2R,3S,6S)-10-oxo-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 174169327 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-O-tert-butyl 3-O-methyl (2R,3S,6S)-10-oxo-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C3C=CC(C3=O)[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21NO5/c1-16(2,3)22-15(20)17-7-10-8-5-6-9(13(8)18)11(10)12(17)14(19)21-4/h5-6,8-12H,7H2,1-4H3/t8?,9?,10-,11+,12+/m1/s1 |
| InChIKey | RSRJYZVDKDPJLQ-UFJRKFNTSA-N |
| XLogP | 1.40 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|