C16H23NO5 — CID 174170232
9-O-tert-butyl 10-O-methyl (1R,2R,4R,6S,7R,10S)-4-hydroxy-9-azatetracyclo[5.3.0.02,4.03,6]decane-9,10-dicarboxylate (PubChem CID 174170232) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 9-O-tert-butyl 10-O-methyl (1R,2R,4R,6S,7R,10S)-4-hydroxy-9-azatetracyclo[5.3.0.02,4.03,6]decane-9,10-dicarboxylate.
| Compound Name | 9-O-tert-butyl 10-O-methyl (1R,2R,4R,6S,7R,10S)-4-hydroxy-9-azatetracyclo[5.3.0.02,4.03,6]decane-9,10-dicarboxylate |
|---|---|
| PubChem CID | 174170232 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 9-O-tert-butyl 10-O-methyl (1R,2R,4R,6S,7R,10S)-4-hydroxy-9-azatetracyclo[5.3.0.02,4.03,6]decane-9,10-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)OC(C)(C)C)C1C[C@@]3(O)C1[C@@H]23 |
| InChI | InChI=1S/C16H23NO5/c1-15(2,3)22-14(19)17-6-8-7-5-16(20)10(7)11(16)9(8)12(17)13(18)21-4/h7-12,20H,5-6H2,1-4H3/t7?,8-,9-,10?,11-,12+,16-/m1/s1 |
| InChIKey | RQFSAAIVDZJDAH-QHNJXHBZSA-N |
| XLogP | 1.02 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |