C8H13N3O4 — CID 16742553
4-aminobutanoic acid;1H-pyrimidine-2,4-dione (PubChem CID 16742553) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 4-aminobutanoic acid;1H-pyrimidine-2,4-dione.
| Compound Name | 4-aminobutanoic acid;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16742553 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-aminobutanoic acid;1H-pyrimidine-2,4-dione |
| SMILES | NCCCC(=O)O.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2.C4H9NO2/c7-3-1-2-5-4(8)6-3;5-3-1-2-4(6)7/h1-2H,(H2,5,6,7,8);1-3,5H2,(H,6,7) |
| InChIKey | KCFZTNGYNJWMSD-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |