C18H16ClN5 — CID 167428583
N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-6-(2-methylprop-1-enyl)-1H-benzimidazol-2-amine (PubChem CID 167428583) has the molecular formula C18H16ClN5 and a molecular weight of 337.81 g/mol. Its IUPAC name is N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-6-(2-methylprop-1-enyl)-1H-benzimidazol-2-amine.
| Compound Name | N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-6-(2-methylprop-1-enyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 167428583 |
| Molecular Formula | C18H16ClN5 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-6-(2-methylprop-1-enyl)-1H-benzimidazol-2-amine |
| SMILES | CC(C)=Cc1ccc2nc(Nc3c[nH]c4ccc(Cl)nc34)[nH]c2c1 |
| InChI | InChI=1S/C18H16ClN5/c1-10(2)7-11-3-4-12-14(8-11)22-18(21-12)23-15-9-20-13-5-6-16(19)24-17(13)15/h3-9,20H,1-2H3,(H2,21,22,23) |
| InChIKey | KYHLJAUUYPXGIZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|