C15H9ClN6 — CID 167428543
2-[(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)amino]-1H-benzimidazole-4-carbonitrile (PubChem CID 167428543) has the molecular formula C15H9ClN6 and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-[(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)amino]-1H-benzimidazole-4-carbonitrile.
| Compound Name | 2-[(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)amino]-1H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 167428543 |
| Molecular Formula | C15H9ClN6 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)amino]-1H-benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2[nH]c(Nc3c[nH]c4ccc(Cl)nc34)nc12 |
| InChI | InChI=1S/C15H9ClN6/c16-12-5-4-9-14(21-12)11(7-18-9)20-15-19-10-3-1-2-8(6-17)13(10)22-15/h1-5,7,18H,(H2,19,20,22) |
| InChIKey | MXPRCHNGXYWDHI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|