C20H22ClN5O4 — CID 167428637
N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-5,6-bis(2-methoxyethoxy)-1H-benzimidazol-2-amine (PubChem CID 167428637) has the molecular formula C20H22ClN5O4 and a molecular weight of 431.88 g/mol. Its IUPAC name is N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-5,6-bis(2-methoxyethoxy)-1H-benzimidazol-2-amine.
| Compound Name | N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-5,6-bis(2-methoxyethoxy)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 167428637 |
| Molecular Formula | C20H22ClN5O4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-5,6-bis(2-methoxyethoxy)-1H-benzimidazol-2-amine |
| SMILES | COCCOc1cc2nc(Nc3c[nH]c4ccc(Cl)nc34)[nH]c2cc1OCCOC |
| InChI | InChI=1S/C20H22ClN5O4/c1-27-5-7-29-16-9-13-14(10-17(16)30-8-6-28-2)24-20(23-13)25-15-11-22-12-3-4-18(21)26-19(12)15/h3-4,9-11,22H,5-8H2,1-2H3,(H2,23,24,25) |
| InChIKey | HSRQBSURXPTOEL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|