C17H16ClN5 — CID 167428648
N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-6-propan-2-yl-1H-benzimidazol-2-amine (PubChem CID 167428648) has the molecular formula C17H16ClN5 and a molecular weight of 325.80 g/mol. Its IUPAC name is N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-6-propan-2-yl-1H-benzimidazol-2-amine.
| Compound Name | N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-6-propan-2-yl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 167428648 |
| Molecular Formula | C17H16ClN5 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)-6-propan-2-yl-1H-benzimidazol-2-amine |
| SMILES | CC(C)c1ccc2nc(Nc3c[nH]c4ccc(Cl)nc34)[nH]c2c1 |
| InChI | InChI=1S/C17H16ClN5/c1-9(2)10-3-4-11-13(7-10)21-17(20-11)22-14-8-19-12-5-6-15(18)23-16(12)14/h3-9,19H,1-2H3,(H2,20,21,22) |
| InChIKey | TWGVCZYYBRDRPH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|