C16H10F6N2O2 — CID 167430172
(Z)-3-hydroxy-2-methyl-1,3-bis[2-(trifluoromethyl)-4-pyridinyl]prop-2-en-1-one (PubChem CID 167430172) has the molecular formula C16H10F6N2O2 and a molecular weight of 376.26 g/mol. Its IUPAC name is (Z)-3-hydroxy-2-methyl-1,3-bis[2-(trifluoromethyl)-4-pyridinyl]prop-2-en-1-one.
| Compound Name | (Z)-3-hydroxy-2-methyl-1,3-bis[2-(trifluoromethyl)-4-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167430172 |
| Molecular Formula | C16H10F6N2O2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (Z)-3-hydroxy-2-methyl-1,3-bis[2-(trifluoromethyl)-4-pyridinyl]prop-2-en-1-one |
| SMILES | C/C(C(=O)c1ccnc(C(F)(F)F)c1)=C(/O)c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F6N2O2/c1-8(13(25)9-2-4-23-11(6-9)15(17,18)19)14(26)10-3-5-24-12(7-10)16(20,21)22/h2-7,25H,1H3/b13-8- |
| InChIKey | CTPMRCNZJGNITK-JYRVWZFOSA-N |
| XLogP | 4.69 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|