C9H15N4NaO7S2 — CID 167432364
sodium [(2S,5R)-2-[(Z)-N'-ethylsulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 167432364) has the molecular formula C9H15N4NaO7S2 and a molecular weight of 378.36 g/mol. Its IUPAC name is sodium [(2S,5R)-2-[(Z)-N'-ethylsulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-[(Z)-N'-ethylsulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 167432364 |
| Molecular Formula | C9H15N4NaO7S2 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | sodium [(2S,5R)-2-[(Z)-N'-ethylsulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | CCS(=O)(=O)/N=C(\N)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H16N4O7S2.Na/c1-2-21(15,16)11-8(10)7-4-3-6-5-12(7)9(14)13(6)20-22(17,18)19;/h6-7H,2-5H2,1H3,(H2,10,11)(H,17,18,19);/q;+1/p-1/t6-,7+;/m1./s1 |
| InChIKey | VDGKXSDGHGSDGB-HHQFNNIRSA-M |
| XLogP | -4.64 |
| TPSA | 162.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|