C25H33N5O3 — CID 167438165
N-[4-(propylaminocarbamoyl)phenyl]-7-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]heptanamide (PubChem CID 167438165) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[4-(propylaminocarbamoyl)phenyl]-7-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]heptanamide.
| Compound Name | N-[4-(propylaminocarbamoyl)phenyl]-7-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]heptanamide |
|---|---|
| PubChem CID | 167438165 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-[4-(propylaminocarbamoyl)phenyl]-7-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]heptanamide |
| SMILES | CCCNNC(=O)c1ccc(NC(=O)CCCCCCNC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C25H33N5O3/c1-2-16-28-30-25(33)21-11-13-22(14-12-21)29-24(32)9-5-3-4-6-18-27-23(31)15-10-20-8-7-17-26-19-20/h7-8,10-15,17,19,28H,2-6,9,16,18H2,1H3,(H,27,31)(H,29,32)(H,30,33)/b15-10+ |
| InChIKey | QHHUXNDUTCMUPI-XNTDXEJSSA-N |
| XLogP | 3.44 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|