C31H38F4N8O2 — CID 167440629
N-[2-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-7-(4-methylpiperazin-1-yl)-5-propan-2-yl-9-(2,2,2-trifluoroethoxy)pyrido[4,3-b]indol-3-amine (PubChem CID 167440629) has the molecular formula C31H38F4N8O2 and a molecular weight of 630.69 g/mol. Its IUPAC name is N-[2-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-7-(4-methylpiperazin-1-yl)-5-propan-2-yl-9-(2,2,2-trifluoroethoxy)pyrido[4,3-b]indol-3-amine.
| Compound Name | N-[2-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-7-(4-methylpiperazin-1-yl)-5-propan-2-yl-9-(2,2,2-trifluoroethoxy)pyrido[4,3-b]indol-3-amine |
|---|---|
| PubChem CID | 167440629 |
| Molecular Formula | C31H38F4N8O2 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | N-[2-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-7-(4-methylpiperazin-1-yl)-5-propan-2-yl-9-(2,2,2-trifluoroethoxy)pyrido[4,3-b]indol-3-amine |
| SMILES | CO[C@H]1CCN(c2nccc(Nc3cc4c(cn3)c3c(OCC(F)(F)F)cc(N5CCN(C)CC5)cc3n4C(C)C)n2)C[C@H]1F |
| InChI | InChI=1S/C31H38F4N8O2/c1-19(2)43-23-15-28(38-27-5-7-36-30(39-27)42-8-6-25(44-4)22(32)17-42)37-16-21(23)29-24(43)13-20(41-11-9-40(3)10-12-41)14-26(29)45-18-31(33,34)35/h5,7,13-16,19,22,25H,6,8-12,17-18H2,1-4H3,(H,36,37,38,39)/t22-,25+/m1/s1 |
| InChIKey | JQZZJZWQWVLDFC-RDGATRHJSA-N |
| XLogP | 5.56 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |