C18H23FN6O — CID 170620820
2-(3-fluoro-4-methoxypiperidin-1-yl)-N-[4-methyl-5-(methyliminomethyl)-2-pyridinyl]pyrimidin-4-amine (PubChem CID 170620820) has the molecular formula C18H23FN6O and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxypiperidin-1-yl)-N-[4-methyl-5-(methyliminomethyl)-2-pyridinyl]pyrimidin-4-amine.
| Compound Name | 2-(3-fluoro-4-methoxypiperidin-1-yl)-N-[4-methyl-5-(methyliminomethyl)-2-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170620820 |
| Molecular Formula | C18H23FN6O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-(3-fluoro-4-methoxypiperidin-1-yl)-N-[4-methyl-5-(methyliminomethyl)-2-pyridinyl]pyrimidin-4-amine |
| SMILES | C/N=C/c1cnc(Nc2ccnc(N3CCC(OC)C(F)C3)n2)cc1C |
| InChI | InChI=1S/C18H23FN6O/c1-12-8-17(22-10-13(12)9-20-2)23-16-4-6-21-18(24-16)25-7-5-15(26-3)14(19)11-25/h4,6,8-10,14-15H,5,7,11H2,1-3H3,(H,21,22,23,24)/b20-9+ |
| InChIKey | ZPFURADHMHLTHX-AWQFTUOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|