C22H27FN2O3 — CID 167445137
N-ethyl-N'-[5-fluoro-4-[3-[(3-methoxyphenyl)methoxy]oxetan-3-yl]-2-methylphenyl]-N-methylmethanimidamide (PubChem CID 167445137) has the molecular formula C22H27FN2O3 and a molecular weight of 386.47 g/mol. Its IUPAC name is N-ethyl-N'-[5-fluoro-4-[3-[(3-methoxyphenyl)methoxy]oxetan-3-yl]-2-methylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[5-fluoro-4-[3-[(3-methoxyphenyl)methoxy]oxetan-3-yl]-2-methylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 167445137 |
| Molecular Formula | C22H27FN2O3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-ethyl-N'-[5-fluoro-4-[3-[(3-methoxyphenyl)methoxy]oxetan-3-yl]-2-methylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(F)c(C2(OCc3cccc(OC)c3)COC2)cc1C |
| InChI | InChI=1S/C22H27FN2O3/c1-5-25(3)15-24-21-11-20(23)19(9-16(21)2)22(13-27-14-22)28-12-17-7-6-8-18(10-17)26-4/h6-11,15H,5,12-14H2,1-4H3/b24-15+ |
| InChIKey | RJBPREPUWCXDGM-BUVRLJJBSA-N |
| XLogP | 4.20 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|