About ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide
ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide (PubChem CID 167447575) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide.
Molecular Properties
| Compound Name | ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide |
| PubChem CID | 167447575 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide |
| SMILES | CC.CCNC(=O)C1=CNCC=N1 |
| InChI | InChI=1S/C7H11N3O.C2H6/c1-2-9-7(11)6-5-8-3-4-10-6;1-2/h4-5,8H,2-3H2,1H3,(H,9,11);1-2H3 |
| InChIKey | HQEWJUCPMDRDPO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide?
The IUPAC name of ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide (CID 167447575) is ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide.
What is the SMILES notation for ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide?
The canonical SMILES for ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide is CC.CCNC(=O)C1=CNCC=N1.
What is the InChIKey of ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide?
The InChIKey is HQEWJUCPMDRDPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O.C2H6/c1-2-9-7(11)6-5-8-3-4-10-6;1-2/h4-5,8H,2-3H2,1H3,(H,9,11);1-2H3.
What are the key properties of ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide?
ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide has a molecular weight of 183.25 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-1,2-dihydropyrazine-5-carboxamide is sourced from PubChem (CID 167447575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).