C20H24O5 — CID 16745542
(3-Butyl-7-methyl-6,8-dioxoisochromen-7-yl) cyclopentanecarboxylate (PubChem CID 16745542) has the molecular formula C20H24O5 and a molecular weight of 344.40 g/mol. Its IUPAC name is (3-butyl-7-methyl-6,8-dioxoisochromen-7-yl) cyclopentanecarboxylate.
| Compound Name | (3-Butyl-7-methyl-6,8-dioxoisochromen-7-yl) cyclopentanecarboxylate |
|---|---|
| PubChem CID | 16745542 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (3-butyl-7-methyl-6,8-dioxoisochromen-7-yl) cyclopentanecarboxylate |
| SMILES | CCCCC1=CC2=CC(=O)C(C(=O)C2=CO1)(C)OC(=O)C3CCCC3 |
| InChI | InChI=1S/C20H24O5/c1-3-4-9-15-10-14-11-17(21)20(2,18(22)16(14)12-24-15)25-19(23)13-7-5-6-8-13/h10-13H,3-9H2,1-2H3 |
| InChIKey | DFLRUMRQZKFKRX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | 691 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|