C16H16O5 — CID 16759454
(3-Cyclopropyl-7-methyl-6,8-dioxoisochromen-7-yl) propanoate (PubChem CID 16759454) has the molecular formula C16H16O5 and a molecular weight of 288.29 g/mol. Its IUPAC name is (3-cyclopropyl-7-methyl-6,8-dioxoisochromen-7-yl) propanoate.
| Compound Name | (3-Cyclopropyl-7-methyl-6,8-dioxoisochromen-7-yl) propanoate |
|---|---|
| PubChem CID | 16759454 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (3-cyclopropyl-7-methyl-6,8-dioxoisochromen-7-yl) propanoate |
| SMILES | CCC(=O)OC1(C(=O)C=C2C=C(OC=C2C1=O)C3CC3)C |
| InChI | InChI=1S/C16H16O5/c1-3-14(18)21-16(2)13(17)7-10-6-12(9-4-5-9)20-8-11(10)15(16)19/h6-9H,3-5H2,1-2H3 |
| InChIKey | HTXITPJNLDKYSV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 633 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|