C18H20O7 — CID 16759468
methyl 4-(7-methyl-6,8-dioxo-7-propanoyloxyisochromen-3-yl)butanoate (PubChem CID 16759468) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is methyl 4-(7-methyl-6,8-dioxo-7-propanoyloxyisochromen-3-yl)butanoate.
| Compound Name | methyl 4-(7-methyl-6,8-dioxo-7-propanoyloxyisochromen-3-yl)butanoate |
|---|---|
| PubChem CID | 16759468 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | methyl 4-(7-methyl-6,8-dioxo-7-propanoyloxyisochromen-3-yl)butanoate |
| SMILES | CCC(=O)OC1(C)C(=O)C=C2C=C(CCCC(=O)OC)OC=C2C1=O |
| InChI | InChI=1S/C18H20O7/c1-4-15(20)25-18(2)14(19)9-11-8-12(6-5-7-16(21)23-3)24-10-13(11)17(18)22/h8-10H,4-7H2,1-3H3 |
| InChIKey | JIYUIYHNIILRJI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|