C25H33ClN4O2 — CID 167456753
3-(6-chloro-4-methoxy-3-pyridinyl)-1-(1-cyclobutylpiperidin-4-yl)-1-(2-propan-2-ylphenyl)urea (PubChem CID 167456753) has the molecular formula C25H33ClN4O2 and a molecular weight of 457.02 g/mol. Its IUPAC name is 3-(6-chloro-4-methoxy-3-pyridinyl)-1-(1-cyclobutylpiperidin-4-yl)-1-(2-propan-2-ylphenyl)urea.
| Compound Name | 3-(6-chloro-4-methoxy-3-pyridinyl)-1-(1-cyclobutylpiperidin-4-yl)-1-(2-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 167456753 |
| Molecular Formula | C25H33ClN4O2 |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-(6-chloro-4-methoxy-3-pyridinyl)-1-(1-cyclobutylpiperidin-4-yl)-1-(2-propan-2-ylphenyl)urea |
| SMILES | COc1cc(Cl)ncc1NC(=O)N(c1ccccc1C(C)C)C1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C25H33ClN4O2/c1-17(2)20-9-4-5-10-22(20)30(19-11-13-29(14-12-19)18-7-6-8-18)25(31)28-21-16-27-24(26)15-23(21)32-3/h4-5,9-10,15-19H,6-8,11-14H2,1-3H3,(H,28,31) |
| InChIKey | VASBVCNRFSDMII-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|