C22H27ClN2O2 — CID 167456287
N-(6-chloro-4-methoxy-3-pyridinyl)-3,3-dimethyl-1-(2-propan-2-ylphenyl)cyclobutane-1-carboxamide (PubChem CID 167456287) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is N-(6-chloro-4-methoxy-3-pyridinyl)-3,3-dimethyl-1-(2-propan-2-ylphenyl)cyclobutane-1-carboxamide.
| Compound Name | N-(6-chloro-4-methoxy-3-pyridinyl)-3,3-dimethyl-1-(2-propan-2-ylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 167456287 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(6-chloro-4-methoxy-3-pyridinyl)-3,3-dimethyl-1-(2-propan-2-ylphenyl)cyclobutane-1-carboxamide |
| SMILES | COc1cc(Cl)ncc1NC(=O)C1(c2ccccc2C(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C22H27ClN2O2/c1-14(2)15-8-6-7-9-16(15)22(12-21(3,4)13-22)20(26)25-17-11-24-19(23)10-18(17)27-5/h6-11,14H,12-13H2,1-5H3,(H,25,26) |
| InChIKey | ZAIPCGZLWZIVNE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|