C26H34ClN3O4 — CID 155413313
4-[3-[(6-chloro-4-ethoxy-3-pyridinyl)carbamoyl]-3-(2-propan-2-ylphenyl)azetidin-1-yl]-2,2-dimethylbutanoic acid (PubChem CID 155413313) has the molecular formula C26H34ClN3O4 and a molecular weight of 488.03 g/mol. Its IUPAC name is 4-[3-[(6-chloro-4-ethoxy-3-pyridinyl)carbamoyl]-3-(2-propan-2-ylphenyl)azetidin-1-yl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[3-[(6-chloro-4-ethoxy-3-pyridinyl)carbamoyl]-3-(2-propan-2-ylphenyl)azetidin-1-yl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 155413313 |
| Molecular Formula | C26H34ClN3O4 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 4-[3-[(6-chloro-4-ethoxy-3-pyridinyl)carbamoyl]-3-(2-propan-2-ylphenyl)azetidin-1-yl]-2,2-dimethylbutanoic acid |
| SMILES | CCOc1cc(Cl)ncc1NC(=O)C1(c2ccccc2C(C)C)CN(CCC(C)(C)C(=O)O)C1 |
| InChI | InChI=1S/C26H34ClN3O4/c1-6-34-21-13-22(27)28-14-20(21)29-23(31)26(19-10-8-7-9-18(19)17(2)3)15-30(16-26)12-11-25(4,5)24(32)33/h7-10,13-14,17H,6,11-12,15-16H2,1-5H3,(H,29,31)(H,32,33) |
| InChIKey | RXPPIFRABBTGPL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|