C24H30FN3O4 — CID 162720225
tert-butyl 3-[(6-fluoro-4-methoxy-3-pyridinyl)carbamoyl]-3-(2-propan-2-ylphenyl)azetidine-1-carboxylate (PubChem CID 162720225) has the molecular formula C24H30FN3O4 and a molecular weight of 443.52 g/mol. Its IUPAC name is tert-butyl 3-[(6-fluoro-4-methoxy-3-pyridinyl)carbamoyl]-3-(2-propan-2-ylphenyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-fluoro-4-methoxy-3-pyridinyl)carbamoyl]-3-(2-propan-2-ylphenyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 162720225 |
| Molecular Formula | C24H30FN3O4 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | tert-butyl 3-[(6-fluoro-4-methoxy-3-pyridinyl)carbamoyl]-3-(2-propan-2-ylphenyl)azetidine-1-carboxylate |
| SMILES | COc1cc(F)ncc1NC(=O)C1(c2ccccc2C(C)C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H30FN3O4/c1-15(2)16-9-7-8-10-17(16)24(13-28(14-24)22(30)32-23(3,4)5)21(29)27-18-12-26-20(25)11-19(18)31-6/h7-12,15H,13-14H2,1-6H3,(H,27,29) |
| InChIKey | KJGRNSVQTAVLSV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|