C21H28ClN5O4S — CID 155743611
N-(6-chloro-4-methoxy-3-pyridinyl)-3-(2-propan-2-ylphenyl)-1-[2-(sulfamoylamino)ethyl]azetidine-3-carboxamide (PubChem CID 155743611) has the molecular formula C21H28ClN5O4S and a molecular weight of 482.01 g/mol. Its IUPAC name is N-(6-chloro-4-methoxy-3-pyridinyl)-3-(2-propan-2-ylphenyl)-1-[2-(sulfamoylamino)ethyl]azetidine-3-carboxamide.
| Compound Name | N-(6-chloro-4-methoxy-3-pyridinyl)-3-(2-propan-2-ylphenyl)-1-[2-(sulfamoylamino)ethyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 155743611 |
| Molecular Formula | C21H28ClN5O4S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-(6-chloro-4-methoxy-3-pyridinyl)-3-(2-propan-2-ylphenyl)-1-[2-(sulfamoylamino)ethyl]azetidine-3-carboxamide |
| SMILES | COc1cc(Cl)ncc1NC(=O)C1(c2ccccc2C(C)C)CN(CCNS(N)(=O)=O)C1 |
| InChI | InChI=1S/C21H28ClN5O4S/c1-14(2)15-6-4-5-7-16(15)21(12-27(13-21)9-8-25-32(23,29)30)20(28)26-17-11-24-19(22)10-18(17)31-3/h4-7,10-11,14,25H,8-9,12-13H2,1-3H3,(H,26,28)(H2,23,29,30) |
| InChIKey | CHPCASOTMSYXTA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|