C22H29ClN4O5S — CID 155413358
N-[6-chloro-4-[(2S)-1-methoxypropan-2-yl]oxy-3-pyridinyl]-3-(2-propan-2-ylphenyl)-1-sulfamoylazetidine-3-carboxamide (PubChem CID 155413358) has the molecular formula C22H29ClN4O5S and a molecular weight of 497.02 g/mol. Its IUPAC name is N-[6-chloro-4-[(2S)-1-methoxypropan-2-yl]oxy-3-pyridinyl]-3-(2-propan-2-ylphenyl)-1-sulfamoylazetidine-3-carboxamide.
| Compound Name | N-[6-chloro-4-[(2S)-1-methoxypropan-2-yl]oxy-3-pyridinyl]-3-(2-propan-2-ylphenyl)-1-sulfamoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 155413358 |
| Molecular Formula | C22H29ClN4O5S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-[6-chloro-4-[(2S)-1-methoxypropan-2-yl]oxy-3-pyridinyl]-3-(2-propan-2-ylphenyl)-1-sulfamoylazetidine-3-carboxamide |
| SMILES | COC[C@H](C)Oc1cc(Cl)ncc1NC(=O)C1(c2ccccc2C(C)C)CN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C22H29ClN4O5S/c1-14(2)16-7-5-6-8-17(16)22(12-27(13-22)33(24,29)30)21(28)26-18-10-25-20(23)9-19(18)32-15(3)11-31-4/h5-10,14-15H,11-13H2,1-4H3,(H,26,28)(H2,24,29,30)/t15-/m0/s1 |
| InChIKey | AYJRJQCBOBCJLO-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|