C18H21ClFN5O4S — CID 155413052
N-(6-chloro-4-methoxy-3-pyridinyl)-3-(6-fluoro-3-propan-2-yl-2-pyridinyl)-1-sulfamoylazetidine-3-carboxamide (PubChem CID 155413052) has the molecular formula C18H21ClFN5O4S and a molecular weight of 457.92 g/mol. Its IUPAC name is N-(6-chloro-4-methoxy-3-pyridinyl)-3-(6-fluoro-3-propan-2-yl-2-pyridinyl)-1-sulfamoylazetidine-3-carboxamide.
| Compound Name | N-(6-chloro-4-methoxy-3-pyridinyl)-3-(6-fluoro-3-propan-2-yl-2-pyridinyl)-1-sulfamoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 155413052 |
| Molecular Formula | C18H21ClFN5O4S |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-(6-chloro-4-methoxy-3-pyridinyl)-3-(6-fluoro-3-propan-2-yl-2-pyridinyl)-1-sulfamoylazetidine-3-carboxamide |
| SMILES | COc1cc(Cl)ncc1NC(=O)C1(c2nc(F)ccc2C(C)C)CN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C18H21ClFN5O4S/c1-10(2)11-4-5-15(20)24-16(11)18(8-25(9-18)30(21,27)28)17(26)23-12-7-22-14(19)6-13(12)29-3/h4-7,10H,8-9H2,1-3H3,(H,23,26)(H2,21,27,28) |
| InChIKey | XTJGJGZSRQSFOG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|