C12H19NO2S — CID 167457575
N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]propane-1-sulfonamide (PubChem CID 167457575) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]propane-1-sulfonamide.
| Compound Name | N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 167457575 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]propane-1-sulfonamide |
| SMILES | C=C/C=C\C(=C/C=C)CNS(=O)(=O)CCC |
| InChI | InChI=1S/C12H19NO2S/c1-4-7-9-12(8-5-2)11-13-16(14,15)10-6-3/h4-5,7-9,13H,1-2,6,10-11H2,3H3/b9-7-,12-8+ |
| InChIKey | HMOBHVPKTMROPE-ZUQSVMQASA-N |
| XLogP | 2.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|