C22H27F3N2O4 — CID 167462558
[1-[4-(trifluoromethyl)phenyl]cyclobutyl] 2-methylidene-4-(2-morpholin-4-ylethylamino)-4-oxobutanoate (PubChem CID 167462558) has the molecular formula C22H27F3N2O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is [1-[4-(trifluoromethyl)phenyl]cyclobutyl] 2-methylidene-4-(2-morpholin-4-ylethylamino)-4-oxobutanoate.
| Compound Name | [1-[4-(trifluoromethyl)phenyl]cyclobutyl] 2-methylidene-4-(2-morpholin-4-ylethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 167462558 |
| Molecular Formula | C22H27F3N2O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [1-[4-(trifluoromethyl)phenyl]cyclobutyl] 2-methylidene-4-(2-morpholin-4-ylethylamino)-4-oxobutanoate |
| SMILES | C=C(CC(=O)NCCN1CCOCC1)C(=O)OC1(c2ccc(C(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C22H27F3N2O4/c1-16(15-19(28)26-9-10-27-11-13-30-14-12-27)20(29)31-21(7-2-8-21)17-3-5-18(6-4-17)22(23,24)25/h3-6H,1-2,7-15H2,(H,26,28) |
| InChIKey | GYCMYJIDUUVVNM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|