C16H15F3O4 — CID 167462540
3-[1-[4-(trifluoromethyl)phenyl]cyclobutyl]oxycarbonylbut-3-enoic acid (PubChem CID 167462540) has the molecular formula C16H15F3O4 and a molecular weight of 328.29 g/mol. Its IUPAC name is 3-[1-[4-(trifluoromethyl)phenyl]cyclobutyl]oxycarbonylbut-3-enoic acid.
| Compound Name | 3-[1-[4-(trifluoromethyl)phenyl]cyclobutyl]oxycarbonylbut-3-enoic acid |
|---|---|
| PubChem CID | 167462540 |
| Molecular Formula | C16H15F3O4 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-[1-[4-(trifluoromethyl)phenyl]cyclobutyl]oxycarbonylbut-3-enoic acid |
| SMILES | C=C(CC(=O)O)C(=O)OC1(c2ccc(C(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C16H15F3O4/c1-10(9-13(20)21)14(22)23-15(7-2-8-15)11-3-5-12(6-4-11)16(17,18)19/h3-6H,1-2,7-9H2,(H,20,21) |
| InChIKey | QHZLHMDQVUXCQQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|