C15H13F3O6S — CID 163274458
4-[1,1-dioxo-3-[4-(trifluoromethyl)phenyl]thietan-3-yl]oxy-2-methylidene-4-oxobutanoic acid (PubChem CID 163274458) has the molecular formula C15H13F3O6S and a molecular weight of 378.32 g/mol. Its IUPAC name is 4-[1,1-dioxo-3-[4-(trifluoromethyl)phenyl]thietan-3-yl]oxy-2-methylidene-4-oxobutanoic acid.
| Compound Name | 4-[1,1-dioxo-3-[4-(trifluoromethyl)phenyl]thietan-3-yl]oxy-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163274458 |
| Molecular Formula | C15H13F3O6S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 4-[1,1-dioxo-3-[4-(trifluoromethyl)phenyl]thietan-3-yl]oxy-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)OC1(c2ccc(C(F)(F)F)cc2)CS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C15H13F3O6S/c1-9(13(20)21)6-12(19)24-14(7-25(22,23)8-14)10-2-4-11(5-3-10)15(16,17)18/h2-5H,1,6-8H2,(H,20,21) |
| InChIKey | BMJOMVKKTVKDLQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|