C18H15F3O4 — CID 163274480
2-methylidene-4-oxo-4-[1-[4-(3,3,3-trifluoroprop-1-ynyl)phenyl]cyclobutyl]oxybutanoic acid (PubChem CID 163274480) has the molecular formula C18H15F3O4 and a molecular weight of 352.31 g/mol. Its IUPAC name is 2-methylidene-4-oxo-4-[1-[4-(3,3,3-trifluoroprop-1-ynyl)phenyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-methylidene-4-oxo-4-[1-[4-(3,3,3-trifluoroprop-1-ynyl)phenyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 163274480 |
| Molecular Formula | C18H15F3O4 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-methylidene-4-oxo-4-[1-[4-(3,3,3-trifluoroprop-1-ynyl)phenyl]cyclobutyl]oxybutanoic acid |
| SMILES | C=C(CC(=O)OC1(c2ccc(C#CC(F)(F)F)cc2)CCC1)C(=O)O |
| InChI | InChI=1S/C18H15F3O4/c1-12(16(23)24)11-15(22)25-17(8-2-9-17)14-5-3-13(4-6-14)7-10-18(19,20)21/h3-6H,1-2,8-9,11H2,(H,23,24) |
| InChIKey | SMRJXYOZWQACFF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|