C16H16F2O4 — CID 163274469
4-[1-[4-(difluoromethyl)phenyl]cyclobutyl]oxy-2-methylidene-4-oxobutanoic acid (PubChem CID 163274469) has the molecular formula C16H16F2O4 and a molecular weight of 310.30 g/mol. Its IUPAC name is 4-[1-[4-(difluoromethyl)phenyl]cyclobutyl]oxy-2-methylidene-4-oxobutanoic acid.
| Compound Name | 4-[1-[4-(difluoromethyl)phenyl]cyclobutyl]oxy-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163274469 |
| Molecular Formula | C16H16F2O4 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[1-[4-(difluoromethyl)phenyl]cyclobutyl]oxy-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)OC1(c2ccc(C(F)F)cc2)CCC1)C(=O)O |
| InChI | InChI=1S/C16H16F2O4/c1-10(15(20)21)9-13(19)22-16(7-2-8-16)12-5-3-11(4-6-12)14(17)18/h3-6,14H,1-2,7-9H2,(H,20,21) |
| InChIKey | VHJAEENWHOQYIX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|