C22H19F3O4 — CID 163274478
2-methylidene-4-oxo-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]cyclobutyl]oxybutanoic acid (PubChem CID 163274478) has the molecular formula C22H19F3O4 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2-methylidene-4-oxo-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-methylidene-4-oxo-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 163274478 |
| Molecular Formula | C22H19F3O4 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-methylidene-4-oxo-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]cyclobutyl]oxybutanoic acid |
| SMILES | C=C(CC(=O)OC1(c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)CCC1)C(=O)O |
| InChI | InChI=1S/C22H19F3O4/c1-14(20(27)28)13-19(26)29-21(11-2-12-21)17-7-3-15(4-8-17)16-5-9-18(10-6-16)22(23,24)25/h3-10H,1-2,11-13H2,(H,27,28) |
| InChIKey | PWWCQEISCCHJJD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|