C18H20F3NO4 — CID 167462554
[1-[4-(trifluoromethyl)phenyl]cyclobutyl] 4-(2-hydroxyethylamino)-2-methylidene-4-oxobutanoate (PubChem CID 167462554) has the molecular formula C18H20F3NO4 and a molecular weight of 371.36 g/mol. Its IUPAC name is [1-[4-(trifluoromethyl)phenyl]cyclobutyl] 4-(2-hydroxyethylamino)-2-methylidene-4-oxobutanoate.
| Compound Name | [1-[4-(trifluoromethyl)phenyl]cyclobutyl] 4-(2-hydroxyethylamino)-2-methylidene-4-oxobutanoate |
|---|---|
| PubChem CID | 167462554 |
| Molecular Formula | C18H20F3NO4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [1-[4-(trifluoromethyl)phenyl]cyclobutyl] 4-(2-hydroxyethylamino)-2-methylidene-4-oxobutanoate |
| SMILES | C=C(CC(=O)NCCO)C(=O)OC1(c2ccc(C(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C18H20F3NO4/c1-12(11-15(24)22-9-10-23)16(25)26-17(7-2-8-17)13-3-5-14(6-4-13)18(19,20)21/h3-6,23H,1-2,7-11H2,(H,22,24) |
| InChIKey | OJWWTYXYILQEPW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|