C24H15N3O — CID 167465111
(3Z)-2-phenyl-3-[2-[(E)-prop-1-enyl]chromen-4-ylidene]prop-1-ene-1,1,3-tricarbonitrile (PubChem CID 167465111) has the molecular formula C24H15N3O and a molecular weight of 361.40 g/mol. Its IUPAC name is (3Z)-2-phenyl-3-[2-[(E)-prop-1-enyl]chromen-4-ylidene]prop-1-ene-1,1,3-tricarbonitrile.
| Compound Name | (3Z)-2-phenyl-3-[2-[(E)-prop-1-enyl]chromen-4-ylidene]prop-1-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 167465111 |
| Molecular Formula | C24H15N3O |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (3Z)-2-phenyl-3-[2-[(E)-prop-1-enyl]chromen-4-ylidene]prop-1-ene-1,1,3-tricarbonitrile |
| SMILES | C/C=C/C1=C/C(=C(/C#N)C(=C(C#N)C#N)c2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C24H15N3O/c1-2-8-19-13-21(20-11-6-7-12-23(20)28-19)22(16-27)24(18(14-25)15-26)17-9-4-3-5-10-17/h2-13H,1H3/b8-2+,22-21+ |
| InChIKey | GZYHOTXDGUQOMG-VUZPBRKYSA-N |
| XLogP | 5.32 |
| TPSA | 80.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|