C18H19NO6 — CID 167470393
2-[3-acetyl-2-[(E)-3-(2,6-dioxopiperidin-3-yl)prop-2-enyl]phenoxy]acetic acid (PubChem CID 167470393) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[3-acetyl-2-[(E)-3-(2,6-dioxopiperidin-3-yl)prop-2-enyl]phenoxy]acetic acid.
| Compound Name | 2-[3-acetyl-2-[(E)-3-(2,6-dioxopiperidin-3-yl)prop-2-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 167470393 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[3-acetyl-2-[(E)-3-(2,6-dioxopiperidin-3-yl)prop-2-enyl]phenoxy]acetic acid |
| SMILES | CC(=O)c1cccc(OCC(=O)O)c1C/C=C/C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H19NO6/c1-11(20)13-5-3-7-15(25-10-17(22)23)14(13)6-2-4-12-8-9-16(21)19-18(12)24/h2-5,7,12H,6,8-10H2,1H3,(H,22,23)(H,19,21,24)/b4-2+ |
| InChIKey | IVIOVQBDODBNSC-DUXPYHPUSA-N |
| XLogP | 1.50 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|